C26H31ClF2N6O2 — CID 142154972
2-[6-chloro-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-2-oxopyrazin-1-yl]-N-[[2-(propylaminomethyl)phenyl]methyl]acetamide;ethene (PubChem CID 142154972) has the molecular formula C26H31ClF2N6O2 and a molecular weight of 533.02 g/mol. Its IUPAC name is 2-[6-chloro-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-2-oxopyrazin-1-yl]-N-[[2-(propylaminomethyl)phenyl]methyl]acetamide;ethene.
| Compound Name | 2-[6-chloro-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-2-oxopyrazin-1-yl]-N-[[2-(propylaminomethyl)phenyl]methyl]acetamide;ethene |
|---|---|
| PubChem CID | 142154972 |
| Molecular Formula | C26H31ClF2N6O2 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 2-[6-chloro-3-[(2,2-difluoro-2-pyridin-2-ylethyl)amino]-2-oxopyrazin-1-yl]-N-[[2-(propylaminomethyl)phenyl]methyl]acetamide;ethene |
| SMILES | C=C.CCCNCc1ccccc1CNC(=O)Cn1c(Cl)cnc(NCC(F)(F)c2ccccn2)c1=O |
| InChI | InChI=1S/C24H27ClF2N6O2.C2H4/c1-2-10-28-12-17-7-3-4-8-18(17)13-30-21(34)15-33-20(25)14-31-22(23(33)35)32-16-24(26,27)19-9-5-6-11-29-19;1-2/h3-9,11,14,28H,2,10,12-13,15-16H2,1H3,(H,30,34)(H,31,32);1-2H2 |
| InChIKey | KMXRCECONDPMFX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|