C8H15N3 — CID 142155883
4-(2,3-dihydro-1H-pyrazol-5-yl)piperidine (PubChem CID 142155883) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-pyrazol-5-yl)piperidine.
| Compound Name | 4-(2,3-dihydro-1H-pyrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 142155883 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 4-(2,3-dihydro-1H-pyrazol-5-yl)piperidine |
| SMILES | C1=C(C2CCNCC2)NNC1 |
| InChI | InChI=1S/C8H15N3/c1-4-9-5-2-7(1)8-3-6-10-11-8/h3,7,9-11H,1-2,4-6H2 |
| InChIKey | SSKVEGOMAGMBHA-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |