C19H17N3O7 — CID 142156257
5-[[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-4-yl]amino]methyl]furan-2-carboxylic acid (PubChem CID 142156257) has the molecular formula C19H17N3O7 and a molecular weight of 399.36 g/mol. Its IUPAC name is 5-[[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-4-yl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-4-yl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 142156257 |
| Molecular Formula | C19H17N3O7 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 5-[[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-4-yl]amino]methyl]furan-2-carboxylic acid |
| SMILES | O=C1CCC(N2C(=O)c3c(NCc4ccc(C(=O)O)o4)cccc3C2O)C(=O)N1 |
| InChI | InChI=1S/C19H17N3O7/c23-14-7-5-12(16(24)21-14)22-17(25)10-2-1-3-11(15(10)18(22)26)20-8-9-4-6-13(29-9)19(27)28/h1-4,6,12,17,20,25H,5,7-8H2,(H,27,28)(H,21,23,24) |
| InChIKey | GQBLQDMTJHMDMK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|