C31H35N3O6 — CID 157023582
4-[[5-[2-(1-adamantyl)ethoxymethyl]furan-2-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 157023582) has the molecular formula C31H35N3O6 and a molecular weight of 545.64 g/mol. Its IUPAC name is 4-[[5-[2-(1-adamantyl)ethoxymethyl]furan-2-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[5-[2-(1-adamantyl)ethoxymethyl]furan-2-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 157023582 |
| Molecular Formula | C31H35N3O6 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 4-[[5-[2-(1-adamantyl)ethoxymethyl]furan-2-yl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCc4ccc(COCCC56CC7CC(CC(C7)C5)C6)o4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H35N3O6/c35-26-7-6-25(28(36)33-26)34-29(37)23-2-1-3-24(27(23)30(34)38)32-16-21-4-5-22(40-21)17-39-9-8-31-13-18-10-19(14-31)12-20(11-18)15-31/h1-5,18-20,25,32H,6-17H2,(H,33,35,36) |
| InChIKey | QQNHDLDTNKQEIN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|