C19H38N2O3 — CID 142156800
ethane;propan-2-yl 4-(1-cyclohexyl-3-hydroxypropan-2-yl)piperazine-1-carboxylate (PubChem CID 142156800) has the molecular formula C19H38N2O3 and a molecular weight of 342.52 g/mol. Its IUPAC name is ethane;propan-2-yl 4-(1-cyclohexyl-3-hydroxypropan-2-yl)piperazine-1-carboxylate.
| Compound Name | ethane;propan-2-yl 4-(1-cyclohexyl-3-hydroxypropan-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142156800 |
| Molecular Formula | C19H38N2O3 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | ethane;propan-2-yl 4-(1-cyclohexyl-3-hydroxypropan-2-yl)piperazine-1-carboxylate |
| SMILES | CC.CC(C)OC(=O)N1CCN(C(CO)CC2CCCCC2)CC1 |
| InChI | InChI=1S/C17H32N2O3.C2H6/c1-14(2)22-17(21)19-10-8-18(9-11-19)16(13-20)12-15-6-4-3-5-7-15;1-2/h14-16,20H,3-13H2,1-2H3;1-2H3 |
| InChIKey | BWDBDYICKUOPSB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |