C20H38N2O3 — CID 56982890
tert-butyl N-[(2S)-1-cyclohexyl-3-hydroxy-4-piperidin-1-ylbutan-2-yl]carbamate (PubChem CID 56982890) has the molecular formula C20H38N2O3 and a molecular weight of 354.54 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-cyclohexyl-3-hydroxy-4-piperidin-1-ylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-cyclohexyl-3-hydroxy-4-piperidin-1-ylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 56982890 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | tert-butyl N-[(2S)-1-cyclohexyl-3-hydroxy-4-piperidin-1-ylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1CCCCC1)C(O)CN1CCCCC1 |
| InChI | InChI=1S/C20H38N2O3/c1-20(2,3)25-19(24)21-17(14-16-10-6-4-7-11-16)18(23)15-22-12-8-5-9-13-22/h16-18,23H,4-15H2,1-3H3,(H,21,24)/t17-,18?/m0/s1 |
| InChIKey | WECRPRPMPUVTER-ZENAZSQFSA-N |
| XLogP | 3.70 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |