C31H45ClN6O2S — CID 142156814
3-amino-N-[3-(4-chlorophenyl)-1-[4-[cyclohexyl-(2-methylsulfanylhydrazinyl)methyl]piperazin-1-yl]-1-oxopropan-2-yl]-3-(2-methylphenyl)propanamide (PubChem CID 142156814) has the molecular formula C31H45ClN6O2S and a molecular weight of 601.26 g/mol. Its IUPAC name is 3-amino-N-[3-(4-chlorophenyl)-1-[4-[cyclohexyl-(2-methylsulfanylhydrazinyl)methyl]piperazin-1-yl]-1-oxopropan-2-yl]-3-(2-methylphenyl)propanamide.
| Compound Name | 3-amino-N-[3-(4-chlorophenyl)-1-[4-[cyclohexyl-(2-methylsulfanylhydrazinyl)methyl]piperazin-1-yl]-1-oxopropan-2-yl]-3-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 142156814 |
| Molecular Formula | C31H45ClN6O2S |
| Molecular Weight | 601.26 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | 3-amino-N-[3-(4-chlorophenyl)-1-[4-[cyclohexyl-(2-methylsulfanylhydrazinyl)methyl]piperazin-1-yl]-1-oxopropan-2-yl]-3-(2-methylphenyl)propanamide |
| SMILES | CSNNC(C1CCCCC1)N1CCN(C(=O)C(Cc2ccc(Cl)cc2)NC(=O)CC(N)c2ccccc2C)CC1 |
| InChI | InChI=1S/C31H45ClN6O2S/c1-22-8-6-7-11-26(22)27(33)21-29(39)34-28(20-23-12-14-25(32)15-13-23)31(40)38-18-16-37(17-19-38)30(35-36-41-2)24-9-4-3-5-10-24/h6-8,11-15,24,27-28,30,35-36H,3-5,9-10,16-21,33H2,1-2H3,(H,34,39) |
| InChIKey | LTYWZEHMBISQSI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|