C19H36FN3 — CID 142157086
(5Z,7Z)-N,N-diethyl-5-(fluoromethyl)-4-(4-methylpiperazin-1-yl)nona-5,7-dien-1-amine (PubChem CID 142157086) has the molecular formula C19H36FN3 and a molecular weight of 325.52 g/mol. Its IUPAC name is (5Z,7Z)-N,N-diethyl-5-(fluoromethyl)-4-(4-methylpiperazin-1-yl)nona-5,7-dien-1-amine.
| Compound Name | (5Z,7Z)-N,N-diethyl-5-(fluoromethyl)-4-(4-methylpiperazin-1-yl)nona-5,7-dien-1-amine |
|---|---|
| PubChem CID | 142157086 |
| Molecular Formula | C19H36FN3 |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.29 |
| IUPAC Name | (5Z,7Z)-N,N-diethyl-5-(fluoromethyl)-4-(4-methylpiperazin-1-yl)nona-5,7-dien-1-amine |
| SMILES | C/C=C\C=C(/CF)C(CCCN(CC)CC)N1CCN(C)CC1 |
| InChI | InChI=1S/C19H36FN3/c1-5-8-10-18(17-20)19(11-9-12-22(6-2)7-3)23-15-13-21(4)14-16-23/h5,8,10,19H,6-7,9,11-17H2,1-4H3/b8-5-,18-10+ |
| InChIKey | QGFNAOUYFFPWNY-PAHMIKEISA-N |
| XLogP | 3.20 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|