C27H31N5 — CID 142157265
N-(cyclopropen-1-ylmethyl)-1-cyclopropyl-N-[[4-methyl-7-(2,4,6-trimethylphenyl)-2,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-3-yl]methyl]methanamine (PubChem CID 142157265) has the molecular formula C27H31N5 and a molecular weight of 425.58 g/mol. Its IUPAC name is N-(cyclopropen-1-ylmethyl)-1-cyclopropyl-N-[[4-methyl-7-(2,4,6-trimethylphenyl)-2,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-3-yl]methyl]methanamine.
| Compound Name | N-(cyclopropen-1-ylmethyl)-1-cyclopropyl-N-[[4-methyl-7-(2,4,6-trimethylphenyl)-2,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-3-yl]methyl]methanamine |
|---|---|
| PubChem CID | 142157265 |
| Molecular Formula | C27H31N5 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | N-(cyclopropen-1-ylmethyl)-1-cyclopropyl-N-[[4-methyl-7-(2,4,6-trimethylphenyl)-2,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaen-3-yl]methyl]methanamine |
| SMILES | Cc1cc(C)c(-n2c3ncccc3n3c(CN(CC4=CC4)CC4CC4)c(C)nc23)c(C)c1 |
| InChI | InChI=1S/C27H31N5/c1-17-12-18(2)25(19(3)13-17)32-26-23(6-5-11-28-26)31-24(20(4)29-27(31)32)16-30(14-21-7-8-21)15-22-9-10-22/h5-7,11-13,22H,8-10,14-16H2,1-4H3 |
| InChIKey | FZWGYBJUYCYBPM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 38.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|