About [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate
[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate (PubChem CID 142158688) has the molecular formula C20H21FN2O2S
and a molecular weight of 372.47 g/mol. Its IUPAC name is [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate.
Molecular Properties
| Compound Name | [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate |
| PubChem CID | 142158688 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate |
| SMILES | CN1CCC(c2c[nH]c3ccc(OS(=O)c4ccc(F)cc4)cc23)CC1 |
| InChI | InChI=1S/C20H21FN2O2S/c1-23-10-8-14(9-11-23)19-13-22-20-7-4-16(12-18(19)20)25-26(24)17-5-2-15(21)3-6-17/h2-7,12-14,22H,8-11H2,1H3 |
| InChIKey | PSBCLGACXDHNPG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate?
The IUPAC name of [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate (CID 142158688) is [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate.
What is the SMILES notation for [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate?
The canonical SMILES for [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate is CN1CCC(c2c[nH]c3ccc(OS(=O)c4ccc(F)cc4)cc23)CC1.
What is the InChIKey of [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate?
The InChIKey is PSBCLGACXDHNPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN2O2S/c1-23-10-8-14(9-11-23)19-13-22-20-7-4-16(12-18(19)20)25-26(24)17-5-2-15(21)3-6-17/h2-7,12-14,22H,8-11H2,1H3.
What are the key properties of [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate?
[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate has a molecular weight of 372.47 g/mol, XLogP of 4.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-methylpiperidin-4-yl)-1H-indol-5-yl] 4-fluorobenzenesulfinate is sourced from PubChem (CID 142158688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).