C20H31NS — CID 142160708
2-[2-(3-cyclohexa-1,3,4-trien-1-ylpropylsulfanyl)cyclohexyl]piperidine (PubChem CID 142160708) has the molecular formula C20H31NS and a molecular weight of 317.54 g/mol. Its IUPAC name is 2-[2-(3-cyclohexa-1,3,4-trien-1-ylpropylsulfanyl)cyclohexyl]piperidine.
| Compound Name | 2-[2-(3-cyclohexa-1,3,4-trien-1-ylpropylsulfanyl)cyclohexyl]piperidine |
|---|---|
| PubChem CID | 142160708 |
| Molecular Formula | C20H31NS |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 2-[2-(3-cyclohexa-1,3,4-trien-1-ylpropylsulfanyl)cyclohexyl]piperidine |
| SMILES | C1=CC=C(CCCSC2CCCCC2C2CCCCN2)CC=1 |
| InChI | InChI=1S/C20H31NS/c1-2-9-17(10-3-1)11-8-16-22-20-14-5-4-12-18(20)19-13-6-7-15-21-19/h2-3,9,18-21H,4-8,10-16H2 |
| InChIKey | BUBHRGCUHKKOSG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|