C18H22N2S — CID 142160931
2-[2-[(2-methylphenyl)methylsulfanyl]phenyl]-1,3-diazinane (PubChem CID 142160931) has the molecular formula C18H22N2S and a molecular weight of 298.46 g/mol. Its IUPAC name is 2-[2-[(2-methylphenyl)methylsulfanyl]phenyl]-1,3-diazinane.
| Compound Name | 2-[2-[(2-methylphenyl)methylsulfanyl]phenyl]-1,3-diazinane |
|---|---|
| PubChem CID | 142160931 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[2-[(2-methylphenyl)methylsulfanyl]phenyl]-1,3-diazinane |
| SMILES | Cc1ccccc1CSc1ccccc1C1NCCCN1 |
| InChI | InChI=1S/C18H22N2S/c1-14-7-2-3-8-15(14)13-21-17-10-5-4-9-16(17)18-19-11-6-12-20-18/h2-5,7-10,18-20H,6,11-13H2,1H3 |
| InChIKey | DVNSYMBIKCRQDM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |