About 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine
6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine (PubChem CID 142162032) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine.
Analyze 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine?
The IUPAC name of 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine (CID 142162032) is 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine.
What is the SMILES notation for 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine?
The canonical SMILES for 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine is CN1CCC2=NCCC=C2C1.
What is the InChIKey of 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine?
The InChIKey is HKQXOKZDAMHEGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-11-6-4-9-8(7-11)3-2-5-10-9/h3H,2,4-7H2,1H3.
What are the key properties of 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine?
6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine has a molecular weight of 150.22 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,5,7,8-tetrahydro-2H-1,6-naphthyridine is sourced from PubChem (CID 142162032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).