About 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide
2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide (PubChem CID 142162801) has the molecular formula C26H36N2O2
and a molecular weight of 408.59 g/mol. Its IUPAC name is 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide.
Molecular Properties
| Compound Name | 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide |
| PubChem CID | 142162801 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide |
| SMILES | [H]/N=C(\N)C(Oc1c(CCC)cc(C(=O)CC)cc1CCC)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C26H36N2O2/c1-6-9-20-15-22(23(29)8-3)16-21(10-7-2)24(20)30-25(26(27)28)19-13-11-18(12-14-19)17(4)5/h11-17,25H,6-10H2,1-5H3,(H3,27,28) |
| InChIKey | XXESAIDAFBXAMC-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide?
The IUPAC name of 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide (CID 142162801) is 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide.
What is the SMILES notation for 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide?
The canonical SMILES for 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide is [H]/N=C(\N)C(Oc1c(CCC)cc(C(=O)CC)cc1CCC)c1ccc(C(C)C)cc1.
What is the InChIKey of 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide?
The InChIKey is XXESAIDAFBXAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36N2O2/c1-6-9-20-15-22(23(29)8-3)16-21(10-7-2)24(20)30-25(26(27)28)19-13-11-18(12-14-19)17(4)5/h11-17,25H,6-10H2,1-5H3,(H3,27,28).
What are the key properties of 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide?
2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide has a molecular weight of 408.59 g/mol, XLogP of 6.36, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-propanoyl-2,6-dipropylphenoxy)-2-(4-propan-2-ylphenyl)ethanimidamide is sourced from PubChem (CID 142162801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).