C22H27F3N4O2 — CID 142162896
N'-amino-2-[3-hydroxy-2,6-dipropyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]-2-phenylethanimidamide (PubChem CID 142162896) has the molecular formula C22H27F3N4O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is N'-amino-2-[3-hydroxy-2,6-dipropyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]-2-phenylethanimidamide.
| Compound Name | N'-amino-2-[3-hydroxy-2,6-dipropyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]-2-phenylethanimidamide |
|---|---|
| PubChem CID | 142162896 |
| Molecular Formula | C22H27F3N4O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N'-amino-2-[3-hydroxy-2,6-dipropyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]-2-phenylethanimidamide |
| SMILES | [H]/N=C(/c1cc(CCC)c(OC(/C(N)=N/N)c2ccccc2)c(CCC)c1O)C(F)(F)F |
| InChI | InChI=1S/C22H27F3N4O2/c1-3-8-14-12-16(20(26)22(23,24)25)17(30)15(9-4-2)18(14)31-19(21(27)29-28)13-10-6-5-7-11-13/h5-7,10-12,19,26,30H,3-4,8-9,28H2,1-2H3,(H2,27,29)/b26-20- |
| InChIKey | VMNAAXJUUHSUKG-QOMWVZHYSA-N |
| XLogP | 4.58 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|