C20H13N5O2 — CID 142163304
20-(methylamino)-3,7,9,13-tetrazahexacyclo[13.7.1.02,13.04,12.06,10.019,23]tricosa-1(23),2,4(12),5,10,15,17,19,21-nonaene-8,14-dione (PubChem CID 142163304) has the molecular formula C20H13N5O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 20-(methylamino)-3,7,9,13-tetrazahexacyclo[13.7.1.02,13.04,12.06,10.019,23]tricosa-1(23),2,4(12),5,10,15,17,19,21-nonaene-8,14-dione.
| Compound Name | 20-(methylamino)-3,7,9,13-tetrazahexacyclo[13.7.1.02,13.04,12.06,10.019,23]tricosa-1(23),2,4(12),5,10,15,17,19,21-nonaene-8,14-dione |
|---|---|
| PubChem CID | 142163304 |
| Molecular Formula | C20H13N5O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 20-(methylamino)-3,7,9,13-tetrazahexacyclo[13.7.1.02,13.04,12.06,10.019,23]tricosa-1(23),2,4(12),5,10,15,17,19,21-nonaene-8,14-dione |
| SMILES | CNc1ccc2c3c1cccc3c(=O)n1c3cc4[nH]c(=O)[nH]c4cc3nc21 |
| InChI | InChI=1S/C20H13N5O2/c1-21-12-6-5-10-17-9(12)3-2-4-11(17)19(26)25-16-8-14-13(23-20(27)24-14)7-15(16)22-18(10)25/h2-8,21H,1H3,(H2,23,24,27) |
| InChIKey | RPUCCGWDEKNXPT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |