C32H20N4O2 — CID 20762340
3,13,20,30-tetrazadecacyclo[16.16.2.02,13.04,12.06,10.015,35.019,30.021,29.023,27.032,36]hexatriaconta-1(35),2,4(12),5,10,15,17,19,21(29),22,27,32(36),33-tridecaene-14,31-dione (PubChem CID 20762340) has the molecular formula C32H20N4O2 and a molecular weight of 492.54 g/mol. Its IUPAC name is 3,13,20,30-tetrazadecacyclo[16.16.2.02,13.04,12.06,10.015,35.019,30.021,29.023,27.032,36]hexatriaconta-1(35),2,4(12),5,10,15,17,19,21(29),22,27,32(36),33-tridecaene-14,31-dione.
| Compound Name | 3,13,20,30-tetrazadecacyclo[16.16.2.02,13.04,12.06,10.015,35.019,30.021,29.023,27.032,36]hexatriaconta-1(35),2,4(12),5,10,15,17,19,21(29),22,27,32(36),33-tridecaene-14,31-dione |
|---|---|
| PubChem CID | 20762340 |
| Molecular Formula | C32H20N4O2 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 3,13,20,30-tetrazadecacyclo[16.16.2.02,13.04,12.06,10.015,35.019,30.021,29.023,27.032,36]hexatriaconta-1(35),2,4(12),5,10,15,17,19,21(29),22,27,32(36),33-tridecaene-14,31-dione |
| SMILES | O=c1c2ccc3c4c(ccc(c24)c2nc4cc5c(cc4n12)CCC5)c(=O)n1c2cc4c(cc2nc31)CCC4 |
| InChI | InChI=1S/C32H20N4O2/c37-31-21-9-8-20-28-22(32(38)36-26-14-18-6-2-4-16(18)12-24(26)34-30(20)36)10-7-19(27(21)28)29-33-23-11-15-3-1-5-17(15)13-25(23)35(29)31/h7-14H,1-6H2 |
| InChIKey | KFZYXLBZNWOFTE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 68.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|