C27H31NO5 — CID 142163684
[(1E,3Z,5Z)-hepta-1,3,5-trienyl] 4-phenylpiperidine-1-carboxylate;5-methoxy-1,3-benzodioxole (PubChem CID 142163684) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is [(1E,3Z,5Z)-hepta-1,3,5-trienyl] 4-phenylpiperidine-1-carboxylate;5-methoxy-1,3-benzodioxole.
| Compound Name | [(1E,3Z,5Z)-hepta-1,3,5-trienyl] 4-phenylpiperidine-1-carboxylate;5-methoxy-1,3-benzodioxole |
|---|---|
| PubChem CID | 142163684 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [(1E,3Z,5Z)-hepta-1,3,5-trienyl] 4-phenylpiperidine-1-carboxylate;5-methoxy-1,3-benzodioxole |
| SMILES | C/C=C\C=C/C=C/OC(=O)N1CCC(c2ccccc2)CC1.COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H23NO2.C8H8O3/c1-2-3-4-5-9-16-22-19(21)20-14-12-18(13-15-20)17-10-7-6-8-11-17;1-9-6-2-3-7-8(4-6)11-5-10-7/h2-11,16,18H,12-15H2,1H3;2-4H,5H2,1H3/b3-2-,5-4-,16-9+; |
| InChIKey | IEXSNYDPQWMVBK-BATSZPOCSA-N |
| XLogP | 6.07 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|