C19H23NO2 — CID 142163685
[(1E,3Z,5Z)-hepta-1,3,5-trienyl] 4-phenylpiperidine-1-carboxylate (PubChem CID 142163685) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is [(1E,3Z,5Z)-hepta-1,3,5-trienyl] 4-phenylpiperidine-1-carboxylate.
| Compound Name | [(1E,3Z,5Z)-hepta-1,3,5-trienyl] 4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142163685 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [(1E,3Z,5Z)-hepta-1,3,5-trienyl] 4-phenylpiperidine-1-carboxylate |
| SMILES | C/C=C\C=C/C=C/OC(=O)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H23NO2/c1-2-3-4-5-9-16-22-19(21)20-14-12-18(13-15-20)17-10-7-6-8-11-17/h2-11,16,18H,12-15H2,1H3/b3-2-,5-4-,16-9+ |
| InChIKey | AMCXIXDSZUHQCR-FAZOHXIJSA-N |
| XLogP | 4.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|