C14H30OSi — CID 14216572
(Z,5R,6R)-5-trimethylsilylundec-3-en-6-ol (PubChem CID 14216572) has the molecular formula C14H30OSi and a molecular weight of 242.48 g/mol. Its IUPAC name is (Z,5R,6R)-5-trimethylsilylundec-3-en-6-ol.
| Compound Name | (Z,5R,6R)-5-trimethylsilylundec-3-en-6-ol |
|---|---|
| PubChem CID | 14216572 |
| Molecular Formula | C14H30OSi |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | (Z,5R,6R)-5-trimethylsilylundec-3-en-6-ol |
| SMILES | CC/C=C\[C@H]([C@H](O)CCCCC)[Si](C)(C)C |
| InChI | InChI=1S/C14H30OSi/c1-6-8-10-11-13(15)14(12-9-7-2)16(3,4)5/h9,12-15H,6-8,10-11H2,1-5H3/b12-9-/t13-,14-/m1/s1 |
| InChIKey | IVTAMDUEARRFII-ISESHHHUSA-N |
| XLogP | 4.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|