C23H27N3O3 — CID 142165772
(Z)-but-2-ene;(5E)-1-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(1-methyl-3-methylidene-2H-pyrrol-4-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 142165772) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (Z)-but-2-ene;(5E)-1-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(1-methyl-3-methylidene-2H-pyrrol-4-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (Z)-but-2-ene;(5E)-1-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(1-methyl-3-methylidene-2H-pyrrol-4-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 142165772 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (Z)-but-2-ene;(5E)-1-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(1-methyl-3-methylidene-2H-pyrrol-4-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | C/C=C\C.C=C1CN(C)C=C1/C=C1\C(=O)NC(=O)N(C2=CC=C(C)C=CC2)C1=O |
| InChI | InChI=1S/C19H19N3O3.C4H8/c1-12-5-4-6-15(8-7-12)22-18(24)16(17(23)20-19(22)25)9-14-11-21(3)10-13(14)2;1-3-4-2/h4-5,7-9,11H,2,6,10H2,1,3H3,(H,20,23,25);3-4H,1-2H3/b16-9+;4-3- |
| InChIKey | LGDGBAOTKDVMQU-VWFOUHAUSA-N |
| XLogP | 3.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|