C15H22O3 — CID 14216789
(2R,3aR,6S,7R,7aS)-6-hydroxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-2'-one (PubChem CID 14216789) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2R,3aR,6S,7R,7aS)-6-hydroxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-2'-one.
| Compound Name | (2R,3aR,6S,7R,7aS)-6-hydroxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-2'-one |
|---|---|
| PubChem CID | 14216789 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2R,3aR,6S,7R,7aS)-6-hydroxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-2'-one |
| SMILES | C=C1COC(=O)[C@@]12C[C@H]1CC[C@H](O)[C@H](C)[C@@]1(C)C2 |
| InChI | InChI=1S/C15H22O3/c1-9-7-18-13(17)15(9)6-11-4-5-12(16)10(2)14(11,3)8-15/h10-12,16H,1,4-8H2,2-3H3/t10-,11+,12-,14+,15+/m0/s1 |
| InChIKey | PYOOLLZTMBWMNO-SZWZKDINSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|