About 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone
1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone (PubChem CID 142169119) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone.
Molecular Properties
| Compound Name | 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone |
| PubChem CID | 142169119 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone |
| SMILES | Cc1cccc(CC(=O)C2=CCC(C)CC=C2)n1 |
| InChI | InChI=1S/C16H19NO/c1-12-5-3-7-14(10-9-12)16(18)11-15-8-4-6-13(2)17-15/h3-4,6-8,10,12H,5,9,11H2,1-2H3 |
| InChIKey | LSIAURXJCSVSGD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone?
The IUPAC name of 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone (CID 142169119) is 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone.
What is the SMILES notation for 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone?
The canonical SMILES for 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone is Cc1cccc(CC(=O)C2=CCC(C)CC=C2)n1.
What is the InChIKey of 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone?
The InChIKey is LSIAURXJCSVSGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO/c1-12-5-3-7-14(10-9-12)16(18)11-15-8-4-6-13(2)17-15/h3-4,6-8,10,12H,5,9,11H2,1-2H3.
What are the key properties of 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone?
1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone has a molecular weight of 241.33 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylcyclohepta-1,6-dien-1-yl)-2-(6-methyl-2-pyridinyl)ethanone is sourced from PubChem (CID 142169119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).