C32H29F5N4O2 — CID 142169387
N-(1-methyl-7-propan-2-yl-2-bicyclo[2.2.1]heptanyl)-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 142169387) has the molecular formula C32H29F5N4O2 and a molecular weight of 596.60 g/mol. Its IUPAC name is N-(1-methyl-7-propan-2-yl-2-bicyclo[2.2.1]heptanyl)-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(1-methyl-7-propan-2-yl-2-bicyclo[2.2.1]heptanyl)-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 142169387 |
| Molecular Formula | C32H29F5N4O2 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | N-(1-methyl-7-propan-2-yl-2-bicyclo[2.2.1]heptanyl)-2-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | CC(C)C1C2CCC1(C)C(NC(=O)c1ccc3nc(-c4ccc(NC(=O)c5c(F)c(F)c(F)c(F)c5F)cc4)[nH]c3c1)C2 |
| InChI | InChI=1S/C32H29F5N4O2/c1-14(2)23-16-10-11-32(23,3)21(13-16)41-30(42)17-6-9-19-20(12-17)40-29(39-19)15-4-7-18(8-5-15)38-31(43)22-24(33)26(35)28(37)27(36)25(22)34/h4-9,12,14,16,21,23H,10-11,13H2,1-3H3,(H,38,43)(H,39,40)(H,41,42) |
| InChIKey | HMVYKMZDJLEURK-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|