C28H39NO4 — CID 142170865
propane;5-(5,8,8-trimethyl-3-pentyl-6,7-dihydro-5H-naphthalene-2-carbonyl)oxypyridine-2-carboxylic acid (PubChem CID 142170865) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is propane;5-(5,8,8-trimethyl-3-pentyl-6,7-dihydro-5H-naphthalene-2-carbonyl)oxypyridine-2-carboxylic acid.
| Compound Name | propane;5-(5,8,8-trimethyl-3-pentyl-6,7-dihydro-5H-naphthalene-2-carbonyl)oxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 142170865 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | propane;5-(5,8,8-trimethyl-3-pentyl-6,7-dihydro-5H-naphthalene-2-carbonyl)oxypyridine-2-carboxylic acid |
| SMILES | CCC.CCCCCc1cc2c(cc1C(=O)Oc1ccc(C(=O)O)nc1)C(C)(C)CCC2C |
| InChI | InChI=1S/C25H31NO4.C3H8/c1-5-6-7-8-17-13-19-16(2)11-12-25(3,4)21(19)14-20(17)24(29)30-18-9-10-22(23(27)28)26-15-18;1-3-2/h9-10,13-16H,5-8,11-12H2,1-4H3,(H,27,28);3H2,1-2H3 |
| InChIKey | ASQQZCGJULFVEX-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|