C25H44N2O2 — CID 142171747
3-(4-butan-2-ylphenoxy)-N,N-diethylpropan-1-amine;1-butylpyrrolidin-2-one (PubChem CID 142171747) has the molecular formula C25H44N2O2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 3-(4-butan-2-ylphenoxy)-N,N-diethylpropan-1-amine;1-butylpyrrolidin-2-one.
| Compound Name | 3-(4-butan-2-ylphenoxy)-N,N-diethylpropan-1-amine;1-butylpyrrolidin-2-one |
|---|---|
| PubChem CID | 142171747 |
| Molecular Formula | C25H44N2O2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | 3-(4-butan-2-ylphenoxy)-N,N-diethylpropan-1-amine;1-butylpyrrolidin-2-one |
| SMILES | CCC(C)c1ccc(OCCCN(CC)CC)cc1.CCCCN1CCCC1=O |
| InChI | InChI=1S/C17H29NO.C8H15NO/c1-5-15(4)16-9-11-17(12-10-16)19-14-8-13-18(6-2)7-3;1-2-3-6-9-7-4-5-8(9)10/h9-12,15H,5-8,13-14H2,1-4H3;2-7H2,1H3 |
| InChIKey | JKSQFBNDSLAUFY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|