C14H16N4O2 — CID 142174628
4-[[(2S)-2-hydroxy-2-phenylethyl]amino]-2-oxo-1H-pyridine-3-carboximidamide (PubChem CID 142174628) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-[[(2S)-2-hydroxy-2-phenylethyl]amino]-2-oxo-1H-pyridine-3-carboximidamide.
| Compound Name | 4-[[(2S)-2-hydroxy-2-phenylethyl]amino]-2-oxo-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 142174628 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-[[(2S)-2-hydroxy-2-phenylethyl]amino]-2-oxo-1H-pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(NC[C@@H](O)c2ccccc2)cc[nH]c1=O |
| InChI | InChI=1S/C14H16N4O2/c15-13(16)12-10(6-7-17-14(12)20)18-8-11(19)9-4-2-1-3-5-9/h1-7,11,19H,8H2,(H3,15,16)(H2,17,18,20)/t11-/m1/s1 |
| InChIKey | VBYCLIGAWMZTKH-LLVKDONJSA-N |
| XLogP | 0.80 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|