About 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene
3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene (PubChem CID 142175614) has the molecular formula C21H27ClFNO4S
and a molecular weight of 443.97 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene.
Molecular Properties
| Compound Name | 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene |
| PubChem CID | 142175614 |
| Molecular Formula | C21H27ClFNO4S |
| Molecular Weight | 443.97 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene |
| SMILES | Cc1ccc(F)cc1.O=S(=O)(c1ccc(Cl)cc1)N1CCC(OCCCO)CC1 |
| InChI | InChI=1S/C14H20ClNO4S.C7H7F/c15-12-2-4-14(5-3-12)21(18,19)16-8-6-13(7-9-16)20-11-1-10-17;1-6-2-4-7(8)5-3-6/h2-5,13,17H,1,6-11H2;2-5H,1H3 |
| InChIKey | RJUVTSXBOIGUJR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.97 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene?
The IUPAC name of 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene (CID 142175614) is 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene.
What is the SMILES notation for 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene?
The canonical SMILES for 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene is Cc1ccc(F)cc1.O=S(=O)(c1ccc(Cl)cc1)N1CCC(OCCCO)CC1.
What is the InChIKey of 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene?
The InChIKey is RJUVTSXBOIGUJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO4S.C7H7F/c15-12-2-4-14(5-3-12)21(18,19)16-8-6-13(7-9-16)20-11-1-10-17;1-6-2-4-7(8)5-3-6/h2-5,13,17H,1,6-11H2;2-5H,1H3.
What are the key properties of 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene?
3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene has a molecular weight of 443.97 g/mol, XLogP of 4.03, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]oxypropan-1-ol;1-fluoro-4-methylbenzene is sourced from PubChem (CID 142175614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).