C30H39NO3 — CID 142176187
3-[4-methyl-3-[[[(E)-1-(4-methylphenyl)hex-3-en-1-yn-3-yl]amino]methyl]phenyl]-2-propan-2-yloxypropanoic acid;prop-1-ene (PubChem CID 142176187) has the molecular formula C30H39NO3 and a molecular weight of 461.65 g/mol. Its IUPAC name is 3-[4-methyl-3-[[[(E)-1-(4-methylphenyl)hex-3-en-1-yn-3-yl]amino]methyl]phenyl]-2-propan-2-yloxypropanoic acid;prop-1-ene.
| Compound Name | 3-[4-methyl-3-[[[(E)-1-(4-methylphenyl)hex-3-en-1-yn-3-yl]amino]methyl]phenyl]-2-propan-2-yloxypropanoic acid;prop-1-ene |
|---|---|
| PubChem CID | 142176187 |
| Molecular Formula | C30H39NO3 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | 3-[4-methyl-3-[[[(E)-1-(4-methylphenyl)hex-3-en-1-yn-3-yl]amino]methyl]phenyl]-2-propan-2-yloxypropanoic acid;prop-1-ene |
| SMILES | C=CC.CC/C=C(\C#Cc1ccc(C)cc1)NCc1cc(CC(OC(C)C)C(=O)O)ccc1C |
| InChI | InChI=1S/C27H33NO3.C3H6/c1-6-7-25(15-14-22-11-8-20(4)9-12-22)28-18-24-16-23(13-10-21(24)5)17-26(27(29)30)31-19(2)3;1-3-2/h7-13,16,19,26,28H,6,17-18H2,1-5H3,(H,29,30);3H,1H2,2H3/b25-7+; |
| InChIKey | WDSRQQNXKBUZNL-WBOBJGEMSA-N |
| XLogP | 6.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|