C24H38N2O4S — CID 142055783
3-[3-[[[(Z)-2-amino-3-propylsulfanylbut-2-enoyl]amino]methyl]-4-methylphenyl]-2-propan-2-yloxypropanoic acid;prop-1-ene (PubChem CID 142055783) has the molecular formula C24H38N2O4S and a molecular weight of 450.65 g/mol. Its IUPAC name is 3-[3-[[[(Z)-2-amino-3-propylsulfanylbut-2-enoyl]amino]methyl]-4-methylphenyl]-2-propan-2-yloxypropanoic acid;prop-1-ene.
| Compound Name | 3-[3-[[[(Z)-2-amino-3-propylsulfanylbut-2-enoyl]amino]methyl]-4-methylphenyl]-2-propan-2-yloxypropanoic acid;prop-1-ene |
|---|---|
| PubChem CID | 142055783 |
| Molecular Formula | C24H38N2O4S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 3-[3-[[[(Z)-2-amino-3-propylsulfanylbut-2-enoyl]amino]methyl]-4-methylphenyl]-2-propan-2-yloxypropanoic acid;prop-1-ene |
| SMILES | C=CC.CCCS/C(C)=C(\N)C(=O)NCc1cc(CC(OC(C)C)C(=O)O)ccc1C |
| InChI | InChI=1S/C21H32N2O4S.C3H6/c1-6-9-28-15(5)19(22)20(24)23-12-17-10-16(8-7-14(17)4)11-18(21(25)26)27-13(2)3;1-3-2/h7-8,10,13,18H,6,9,11-12,22H2,1-5H3,(H,23,24)(H,25,26);3H,1H2,2H3/b19-15-; |
| InChIKey | DFBWZWIXIWBDDM-HVENRQQKSA-N |
| XLogP | 4.56 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|