C27H33N5O4S — CID 142176450
2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[4-[1-(3,4-dihydro-2H-pyrrol-5-yl)piperidin-4-yl]oxyphenyl]sulfinamoyl]acetic acid (PubChem CID 142176450) has the molecular formula C27H33N5O4S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[4-[1-(3,4-dihydro-2H-pyrrol-5-yl)piperidin-4-yl]oxyphenyl]sulfinamoyl]acetic acid.
| Compound Name | 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[4-[1-(3,4-dihydro-2H-pyrrol-5-yl)piperidin-4-yl]oxyphenyl]sulfinamoyl]acetic acid |
|---|---|
| PubChem CID | 142176450 |
| Molecular Formula | C27H33N5O4S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 2-[[(E)-3-(3-carbamimidoylphenyl)prop-2-enyl]-[4-[1-(3,4-dihydro-2H-pyrrol-5-yl)piperidin-4-yl]oxyphenyl]sulfinamoyl]acetic acid |
| SMILES | [H]/N=C(\N)c1cccc(/C=C/CN(c2ccc(OC3CCN(C4=NCCC4)CC3)cc2)S(=O)CC(=O)O)c1 |
| InChI | InChI=1S/C27H33N5O4S/c28-27(29)21-6-1-4-20(18-21)5-3-15-32(37(35)19-26(33)34)22-8-10-23(11-9-22)36-24-12-16-31(17-13-24)25-7-2-14-30-25/h1,3-6,8-11,18,24H,2,7,12-17,19H2,(H3,28,29)(H,33,34)/b5-3+ |
| InChIKey | MVXNZPZADYAPMS-HWKANZROSA-N |
| XLogP | 3.27 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|