About ethane;1-methylpyridin-2-imine
ethane;1-methylpyridin-2-imine (PubChem CID 142176496) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is ethane;1-methylpyridin-2-imine.
Molecular Properties
| Compound Name | ethane;1-methylpyridin-2-imine |
| PubChem CID | 142176496 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | ethane;1-methylpyridin-2-imine |
| SMILES | CC.[H]/N=c1\ccccn1C |
| InChI | InChI=1S/C6H8N2.C2H6/c1-8-5-3-2-4-6(8)7;1-2/h2-5,7H,1H3;1-2H3/b7-6+; |
| InChIKey | TZYRBMOLDHSFFL-UHDJGPCESA-N |
| XLogP | 1.53 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylpyridin-2-imine?
The IUPAC name of ethane;1-methylpyridin-2-imine (CID 142176496) is ethane;1-methylpyridin-2-imine.
What is the SMILES notation for ethane;1-methylpyridin-2-imine?
The canonical SMILES for ethane;1-methylpyridin-2-imine is CC.[H]/N=c1\ccccn1C.
What is the InChIKey of ethane;1-methylpyridin-2-imine?
The InChIKey is TZYRBMOLDHSFFL-UHDJGPCESA-N. The full InChI is InChI=1S/C6H8N2.C2H6/c1-8-5-3-2-4-6(8)7;1-2/h2-5,7H,1H3;1-2H3/b7-6+;.
What are the key properties of ethane;1-methylpyridin-2-imine?
ethane;1-methylpyridin-2-imine has a molecular weight of 138.21 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylpyridin-2-imine is sourced from PubChem (CID 142176496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).