C24H33N3O3 — CID 142176901
4-hydroxy-N-[(4-methylmorpholin-2-yl)methyl]benzamide;2-methyl-4-phenylbutan-1-imine (PubChem CID 142176901) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-hydroxy-N-[(4-methylmorpholin-2-yl)methyl]benzamide;2-methyl-4-phenylbutan-1-imine.
| Compound Name | 4-hydroxy-N-[(4-methylmorpholin-2-yl)methyl]benzamide;2-methyl-4-phenylbutan-1-imine |
|---|---|
| PubChem CID | 142176901 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 4-hydroxy-N-[(4-methylmorpholin-2-yl)methyl]benzamide;2-methyl-4-phenylbutan-1-imine |
| SMILES | CN1CCOC(CNC(=O)c2ccc(O)cc2)C1.[H]/N=C/C(C)CCc1ccccc1 |
| InChI | InChI=1S/C13H18N2O3.C11H15N/c1-15-6-7-18-12(9-15)8-14-13(17)10-2-4-11(16)5-3-10;1-10(9-12)7-8-11-5-3-2-4-6-11/h2-5,12,16H,6-9H2,1H3,(H,14,17);2-6,9-10,12H,7-8H2,1H3/b;12-9+ |
| InChIKey | XYZKIQAPNXXLSW-UWHSOXSGSA-N |
| XLogP | 3.36 |
| TPSA | 85.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|