C20H26N4O3 — CID 142177144
N-benzylformamide;N-[(4-methylmorpholin-2-yl)methyl]pyridine-4-carboxamide (PubChem CID 142177144) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-benzylformamide;N-[(4-methylmorpholin-2-yl)methyl]pyridine-4-carboxamide.
| Compound Name | N-benzylformamide;N-[(4-methylmorpholin-2-yl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 142177144 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-benzylformamide;N-[(4-methylmorpholin-2-yl)methyl]pyridine-4-carboxamide |
| SMILES | CN1CCOC(CNC(=O)c2ccncc2)C1.O=CNCc1ccccc1 |
| InChI | InChI=1S/C12H17N3O2.C8H9NO/c1-15-6-7-17-11(9-15)8-14-12(16)10-2-4-13-5-3-10;10-7-9-6-8-4-2-1-3-5-8/h2-5,11H,6-9H2,1H3,(H,14,16);1-5,7H,6H2,(H,9,10) |
| InChIKey | RNNHGVLOCXORHM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|