About 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole
1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole (PubChem CID 142176988) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole.
Analyze 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole?
The IUPAC name of 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole (CID 142176988) is 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole.
What is the SMILES notation for 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole?
The canonical SMILES for 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole is C/C=C\C1=CN(C)CC1.
What is the InChIKey of 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole?
The InChIKey is SPZQNJGMRSFCSS-ARJAWSKDSA-N. The full InChI is InChI=1S/C8H13N/c1-3-4-8-5-6-9(2)7-8/h3-4,7H,5-6H2,1-2H3/b4-3-.
What are the key properties of 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole?
1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole has a molecular weight of 123.20 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydropyrrole is sourced from PubChem (CID 142176988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).