C20H35N3 — CID 142177923
1,5-dimethyl-3-methylidene-9-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,5,9-triazacyclododecane (PubChem CID 142177923) has the molecular formula C20H35N3 and a molecular weight of 317.52 g/mol. Its IUPAC name is 1,5-dimethyl-3-methylidene-9-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,5,9-triazacyclododecane.
| Compound Name | 1,5-dimethyl-3-methylidene-9-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,5,9-triazacyclododecane |
|---|---|
| PubChem CID | 142177923 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | 1,5-dimethyl-3-methylidene-9-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,5,9-triazacyclododecane |
| SMILES | C=C/C=C(\C=C/C)CN1CCCN(C)CC(=C)CN(C)CCC1 |
| InChI | InChI=1S/C20H35N3/c1-6-10-20(11-7-2)18-23-14-8-12-21(4)16-19(3)17-22(5)13-9-15-23/h6-7,10-11H,1,3,8-9,12-18H2,2,4-5H3/b11-7-,20-10+ |
| InChIKey | ZEJIBABKRBVWKZ-KBNINJOHSA-N |
| XLogP | 3.19 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|