C12H17NS — CID 142178524
(5E)-5-ethylidene-2-methyl-4-(4-methylpenta-1,3-dienyl)-4H-1,3-thiazole (PubChem CID 142178524) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is (5E)-5-ethylidene-2-methyl-4-(4-methylpenta-1,3-dienyl)-4H-1,3-thiazole.
| Compound Name | (5E)-5-ethylidene-2-methyl-4-(4-methylpenta-1,3-dienyl)-4H-1,3-thiazole |
|---|---|
| PubChem CID | 142178524 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (5E)-5-ethylidene-2-methyl-4-(4-methylpenta-1,3-dienyl)-4H-1,3-thiazole |
| SMILES | C/C=C1/SC(C)=NC1C=CC=C(C)C |
| InChI | InChI=1S/C12H17NS/c1-5-12-11(13-10(4)14-12)8-6-7-9(2)3/h5-8,11H,1-4H3/b8-6?,12-5+ |
| InChIKey | SHVNGBRYUJSNTH-ADLLAFHZSA-N |
| XLogP | 3.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|