C19H28N2O3 — CID 142181733
1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-ethylbenzimidazol-2-one;ethane (PubChem CID 142181733) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-ethylbenzimidazol-2-one;ethane.
| Compound Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-ethylbenzimidazol-2-one;ethane |
|---|---|
| PubChem CID | 142181733 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3-ethylbenzimidazol-2-one;ethane |
| SMILES | CC.CCn1c(=O)n(C2CCC3(CC2)OCCO3)c2ccccc21 |
| InChI | InChI=1S/C17H22N2O3.C2H6/c1-2-18-14-5-3-4-6-15(14)19(16(18)20)13-7-9-17(10-8-13)21-11-12-22-17;1-2/h3-6,13H,2,7-12H2,1H3;1-2H3 |
| InChIKey | RQODXZNKGVZDOF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 45.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |