About ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate
ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate (PubChem CID 142181756) has the molecular formula C22H29NO3
and a molecular weight of 355.48 g/mol. Its IUPAC name is ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate |
| PubChem CID | 142181756 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate |
| SMILES | C=C.C=C/C(=C\C)CN1CCC(C(=O)OC)(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H25NO3.C2H4/c1-4-16(5-2)15-21-13-11-20(12-14-21,19(23)24-3)18(22)17-9-7-6-8-10-17;1-2/h4-10H,1,11-15H2,2-3H3;1-2H2/b16-5+; |
| InChIKey | QAKNEVOIGWMEGU-SYRJXDITSA-N |
| XLogP | 4.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate?
The IUPAC name of ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate (CID 142181756) is ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate.
What is the SMILES notation for ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate?
The canonical SMILES for ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate is C=C.C=C/C(=C\C)CN1CCC(C(=O)OC)(C(=O)c2ccccc2)CC1.
What is the InChIKey of ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate?
The InChIKey is QAKNEVOIGWMEGU-SYRJXDITSA-N. The full InChI is InChI=1S/C20H25NO3.C2H4/c1-4-16(5-2)15-21-13-11-20(12-14-21,19(23)24-3)18(22)17-9-7-6-8-10-17;1-2/h4-10H,1,11-15H2,2-3H3;1-2H2/b16-5+;.
What are the key properties of ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate?
ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate has a molecular weight of 355.48 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;methyl 4-benzoyl-1-[(E)-2-ethenylbut-2-enyl]piperidine-4-carboxylate is sourced from PubChem (CID 142181756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).