C31H48NO5PS — CID 142182662
S-[1-[[2-[(2S)-4-cyclohexyl-2-(1-hydroxyethenyl)pyrrolidin-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphoryl]oxy-2-methylpropyl] propanethioate (PubChem CID 142182662) has the molecular formula C31H48NO5PS and a molecular weight of 577.77 g/mol. Its IUPAC name is S-[1-[[2-[(2S)-4-cyclohexyl-2-(1-hydroxyethenyl)pyrrolidin-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphoryl]oxy-2-methylpropyl] propanethioate.
| Compound Name | S-[1-[[2-[(2S)-4-cyclohexyl-2-(1-hydroxyethenyl)pyrrolidin-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphoryl]oxy-2-methylpropyl] propanethioate |
|---|---|
| PubChem CID | 142182662 |
| Molecular Formula | C31H48NO5PS |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | S-[1-[[2-[(2S)-4-cyclohexyl-2-(1-hydroxyethenyl)pyrrolidin-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphoryl]oxy-2-methylpropyl] propanethioate |
| SMILES | C=C(O)[C@@H]1CC(C2CCCCC2)CN1C(=O)CP(=O)(CCCCc1ccccc1)OC(SC(=O)CC)C(C)C |
| InChI | InChI=1S/C31H48NO5PS/c1-5-30(35)39-31(23(2)3)37-38(36,19-13-12-16-25-14-8-6-9-15-25)22-29(34)32-21-27(20-28(32)24(4)33)26-17-10-7-11-18-26/h6,8-9,14-15,23,26-28,31,33H,4-5,7,10-13,16-22H2,1-3H3/t27?,28-,31?,38?/m0/s1 |
| InChIKey | SYFMJNWSUYIWKC-HCLQNIDZSA-N |
| XLogP | 7.82 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|