C31H48NO7P — CID 67474671
(2S,4S)-4-cyclohexyl-1-[2-[4-(4-methylphenyl)butyl-(2-methyl-1-propanoyloxypropoxy)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 67474671) has the molecular formula C31H48NO7P and a molecular weight of 577.70 g/mol. Its IUPAC name is (2S,4S)-4-cyclohexyl-1-[2-[4-(4-methylphenyl)butyl-(2-methyl-1-propanoyloxypropoxy)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-cyclohexyl-1-[2-[4-(4-methylphenyl)butyl-(2-methyl-1-propanoyloxypropoxy)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67474671 |
| Molecular Formula | C31H48NO7P |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | (2S,4S)-4-cyclohexyl-1-[2-[4-(4-methylphenyl)butyl-(2-methyl-1-propanoyloxypropoxy)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCC(=O)OC(OP(=O)(CCCCc1ccc(C)cc1)CC(=O)N1C[C@H](C2CCCCC2)C[C@H]1C(=O)O)C(C)C |
| InChI | InChI=1S/C31H48NO7P/c1-5-29(34)38-31(22(2)3)39-40(37,18-10-9-11-24-16-14-23(4)15-17-24)21-28(33)32-20-26(19-27(32)30(35)36)25-12-7-6-8-13-25/h14-17,22,25-27,31H,5-13,18-21H2,1-4H3,(H,35,36)/t26-,27+,31?,40?/m1/s1 |
| InChIKey | WVWCSQXYGVSUCC-JPDQIIBFSA-N |
| XLogP | 6.43 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|