C25H33N3O3 — CID 142183165
(2S)-2-amino-N-(cyclopropylmethyl)-3-(2-methyl-1H-indol-3-yl)propanamide;1,3-benzodioxole;ethane (PubChem CID 142183165) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is (2S)-2-amino-N-(cyclopropylmethyl)-3-(2-methyl-1H-indol-3-yl)propanamide;1,3-benzodioxole;ethane.
| Compound Name | (2S)-2-amino-N-(cyclopropylmethyl)-3-(2-methyl-1H-indol-3-yl)propanamide;1,3-benzodioxole;ethane |
|---|---|
| PubChem CID | 142183165 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | (2S)-2-amino-N-(cyclopropylmethyl)-3-(2-methyl-1H-indol-3-yl)propanamide;1,3-benzodioxole;ethane |
| SMILES | CC.Cc1[nH]c2ccccc2c1C[C@H](N)C(=O)NCC1CC1.c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H21N3O.C7H6O2.C2H6/c1-10-13(12-4-2-3-5-15(12)19-10)8-14(17)16(20)18-9-11-6-7-11;1-2-4-7-6(3-1)8-5-9-7;1-2/h2-5,11,14,19H,6-9,17H2,1H3,(H,18,20);1-4H,5H2;1-2H3/t14-;;/m0../s1 |
| InChIKey | MBJRXAFRRMBPSV-UTLKBRERSA-N |
| XLogP | 4.31 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|