C19H26N2O2 — CID 44719141
ethyl 2-amino-3-(2-cyclohexyl-1H-indol-3-yl)propanoate (PubChem CID 44719141) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is ethyl 2-amino-3-(2-cyclohexyl-1H-indol-3-yl)propanoate.
| Compound Name | ethyl 2-amino-3-(2-cyclohexyl-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 44719141 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | ethyl 2-amino-3-(2-cyclohexyl-1H-indol-3-yl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1c(C2CCCCC2)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H26N2O2/c1-2-23-19(22)16(20)12-15-14-10-6-7-11-17(14)21-18(15)13-8-4-3-5-9-13/h6-7,10-11,13,16,21H,2-5,8-9,12,20H2,1H3 |
| InChIKey | XEANLDVEHBEEMK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |