C24H24N4O3 — CID 142183963
(2Z,4E)-4-[[2-(isoquinolin-3-ylcarbamoyl)anilino]methyl]-2-(methylamino)hexa-2,4-dienoic acid (PubChem CID 142183963) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is (2Z,4E)-4-[[2-(isoquinolin-3-ylcarbamoyl)anilino]methyl]-2-(methylamino)hexa-2,4-dienoic acid.
| Compound Name | (2Z,4E)-4-[[2-(isoquinolin-3-ylcarbamoyl)anilino]methyl]-2-(methylamino)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 142183963 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2Z,4E)-4-[[2-(isoquinolin-3-ylcarbamoyl)anilino]methyl]-2-(methylamino)hexa-2,4-dienoic acid |
| SMILES | C/C=C(\C=C(/NC)C(=O)O)CNc1ccccc1C(=O)Nc1cc2ccccc2cn1 |
| InChI | InChI=1S/C24H24N4O3/c1-3-16(12-21(25-2)24(30)31)14-26-20-11-7-6-10-19(20)23(29)28-22-13-17-8-4-5-9-18(17)15-27-22/h3-13,15,25-26H,14H2,1-2H3,(H,30,31)(H,27,28,29)/b16-3+,21-12- |
| InChIKey | ZPJCRDHYISPGDN-ROWDRCNBSA-N |
| XLogP | 4.03 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|