C13H10F2N2 — CID 142184146
6,7-difluoro-2-propan-2-ylquinoline-3-carbonitrile (PubChem CID 142184146) has the molecular formula C13H10F2N2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 6,7-difluoro-2-propan-2-ylquinoline-3-carbonitrile.
| Compound Name | 6,7-difluoro-2-propan-2-ylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 142184146 |
| Molecular Formula | C13H10F2N2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 6,7-difluoro-2-propan-2-ylquinoline-3-carbonitrile |
| SMILES | CC(C)c1nc2cc(F)c(F)cc2cc1C#N |
| InChI | InChI=1S/C13H10F2N2/c1-7(2)13-9(6-16)3-8-4-10(14)11(15)5-12(8)17-13/h3-5,7H,1-2H3 |
| InChIKey | DUEGRMIMUOEJOT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |