C11H6F2N2 — CID 154554859
6,7-difluoro-2-methylquinoline-3-carbonitrile (PubChem CID 154554859) has the molecular formula C11H6F2N2 and a molecular weight of 204.18 g/mol. Its IUPAC name is 6,7-difluoro-2-methylquinoline-3-carbonitrile.
| Compound Name | 6,7-difluoro-2-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 154554859 |
| Molecular Formula | C11H6F2N2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 6,7-difluoro-2-methylquinoline-3-carbonitrile |
| SMILES | Cc1nc2cc(F)c(F)cc2cc1C#N |
| InChI | InChI=1S/C11H6F2N2/c1-6-8(5-14)2-7-3-9(12)10(13)4-11(7)15-6/h2-4H,1H3 |
| InChIKey | XAVIZRDFFANFJH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |