C8H4BrN3 — CID 12535770
2-bromo-6-methylpyridine-3,5-dicarbonitrile (PubChem CID 12535770) has the molecular formula C8H4BrN3 and a molecular weight of 222.04 g/mol. Its IUPAC name is 2-bromo-6-methylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-bromo-6-methylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 12535770 |
| Molecular Formula | C8H4BrN3 |
| Molecular Weight | 222.04 g/mol |
| Exact Mass | 220.96 |
| IUPAC Name | 2-bromo-6-methylpyridine-3,5-dicarbonitrile |
| SMILES | Cc1nc(Br)c(C#N)cc1C#N |
| InChI | InChI=1S/C8H4BrN3/c1-5-6(3-10)2-7(4-11)8(9)12-5/h2H,1H3 |
| InChIKey | UXHOMOUSTHAECR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.04 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|