C10H14N4 — CID 171789789
5-amino-2-methyl-6-(propan-2-ylamino)pyridine-3-carbonitrile (PubChem CID 171789789) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-amino-2-methyl-6-(propan-2-ylamino)pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-methyl-6-(propan-2-ylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171789789 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 5-amino-2-methyl-6-(propan-2-ylamino)pyridine-3-carbonitrile |
| SMILES | Cc1nc(NC(C)C)c(N)cc1C#N |
| InChI | InChI=1S/C10H14N4/c1-6(2)13-10-9(12)4-8(5-11)7(3)14-10/h4,6H,12H2,1-3H3,(H,13,14) |
| InChIKey | MERXBUHPEGRQEY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |