C20H32N2O5S — CID 142185141
methoxymethylbenzene;(2S)-2-[[2-methyl-2-[(3-methyl-2-sulfanylbutanoyl)amino]propanoyl]amino]propanoic acid (PubChem CID 142185141) has the molecular formula C20H32N2O5S and a molecular weight of 412.55 g/mol. Its IUPAC name is methoxymethylbenzene;(2S)-2-[[2-methyl-2-[(3-methyl-2-sulfanylbutanoyl)amino]propanoyl]amino]propanoic acid.
| Compound Name | methoxymethylbenzene;(2S)-2-[[2-methyl-2-[(3-methyl-2-sulfanylbutanoyl)amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 142185141 |
| Molecular Formula | C20H32N2O5S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | methoxymethylbenzene;(2S)-2-[[2-methyl-2-[(3-methyl-2-sulfanylbutanoyl)amino]propanoyl]amino]propanoic acid |
| SMILES | CC(C)C(S)C(=O)NC(C)(C)C(=O)N[C@@H](C)C(=O)O.COCc1ccccc1 |
| InChI | InChI=1S/C12H22N2O4S.C8H10O/c1-6(2)8(19)9(15)14-12(4,5)11(18)13-7(3)10(16)17;1-9-7-8-5-3-2-4-6-8/h6-8,19H,1-5H3,(H,13,18)(H,14,15)(H,16,17);2-6H,7H2,1H3/t7-,8?;/m0./s1 |
| InChIKey | KUBLIMNECVETKS-JPPWUZRISA-N |
| XLogP | 2.26 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|