C13H19IN2O — CID 142187098
1-[4-[(2E,4Z,6E)-7-iodohepta-2,4,6-trien-3-yl]piperazin-1-yl]ethanone (PubChem CID 142187098) has the molecular formula C13H19IN2O and a molecular weight of 346.21 g/mol. Its IUPAC name is 1-[4-[(2E,4Z,6E)-7-iodohepta-2,4,6-trien-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[(2E,4Z,6E)-7-iodohepta-2,4,6-trien-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 142187098 |
| Molecular Formula | C13H19IN2O |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 1-[4-[(2E,4Z,6E)-7-iodohepta-2,4,6-trien-3-yl]piperazin-1-yl]ethanone |
| SMILES | C/C=C(\C=C/C=C/I)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C13H19IN2O/c1-3-13(6-4-5-7-14)16-10-8-15(9-11-16)12(2)17/h3-7H,8-11H2,1-2H3/b6-4-,7-5+,13-3+ |
| InChIKey | YNQIAEOCHZXSGY-PITFOQCZSA-N |
| XLogP | 2.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|